C19H25N3O3 — CID 97144465
7-[(2R)-2-(3-methoxypropyl)piperidine-1-carbonyl]-3-methylquinazolin-4-one (PubChem CID 97144465) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 7-[(2R)-2-(3-methoxypropyl)piperidine-1-carbonyl]-3-methylquinazolin-4-one.
| Compound Name | 7-[(2R)-2-(3-methoxypropyl)piperidine-1-carbonyl]-3-methylquinazolin-4-one |
|---|---|
| PubChem CID | 97144465 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 7-[(2R)-2-(3-methoxypropyl)piperidine-1-carbonyl]-3-methylquinazolin-4-one |
| SMILES | COCCC[C@H]1CCCCN1C(=O)c1ccc2c(=O)n(C)cnc2c1 |
| InChI | InChI=1S/C19H25N3O3/c1-21-13-20-17-12-14(8-9-16(17)19(21)24)18(23)22-10-4-3-6-15(22)7-5-11-25-2/h8-9,12-13,15H,3-7,10-11H2,1-2H3/t15-/m1/s1 |
| InChIKey | HJUHSPUCBDYRRE-OAHLLOKOSA-N |
| XLogP | 2.35 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|