C21H32N2O4 — CID 97113189
(4-methoxy-3-morpholin-4-ylphenyl)-[(2S)-2-(3-methoxypropyl)piperidin-1-yl]methanone (PubChem CID 97113189) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is (4-methoxy-3-morpholin-4-ylphenyl)-[(2S)-2-(3-methoxypropyl)piperidin-1-yl]methanone.
| Compound Name | (4-methoxy-3-morpholin-4-ylphenyl)-[(2S)-2-(3-methoxypropyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 97113189 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | (4-methoxy-3-morpholin-4-ylphenyl)-[(2S)-2-(3-methoxypropyl)piperidin-1-yl]methanone |
| SMILES | COCCC[C@@H]1CCCCN1C(=O)c1ccc(OC)c(N2CCOCC2)c1 |
| InChI | InChI=1S/C21H32N2O4/c1-25-13-5-7-18-6-3-4-10-23(18)21(24)17-8-9-20(26-2)19(16-17)22-11-14-27-15-12-22/h8-9,16,18H,3-7,10-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | LCLFXGXGUANGED-SFHVURJKSA-N |
| XLogP | 2.95 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|