C15H23F2N3O2 — CID 71811402
[3-(difluoromethyl)-1-methylpyrazol-4-yl]-[2-(3-methoxypropyl)piperidin-1-yl]methanone (PubChem CID 71811402) has the molecular formula C15H23F2N3O2 and a molecular weight of 315.36 g/mol. Its IUPAC name is [3-(difluoromethyl)-1-methylpyrazol-4-yl]-[2-(3-methoxypropyl)piperidin-1-yl]methanone.
| Compound Name | [3-(difluoromethyl)-1-methylpyrazol-4-yl]-[2-(3-methoxypropyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 71811402 |
| Molecular Formula | C15H23F2N3O2 |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | [3-(difluoromethyl)-1-methylpyrazol-4-yl]-[2-(3-methoxypropyl)piperidin-1-yl]methanone |
| SMILES | COCCCC1CCCCN1C(=O)c1cn(C)nc1C(F)F |
| InChI | InChI=1S/C15H23F2N3O2/c1-19-10-12(13(18-19)14(16)17)15(21)20-8-4-3-6-11(20)7-5-9-22-2/h10-11,14H,3-9H2,1-2H3 |
| InChIKey | QTWYAAWILFDCJA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|