C13H20BrN3O — CID 102802319
[2-(3-bromopropyl)pyrrolidin-1-yl]-(1,3-dimethylpyrazol-4-yl)methanone (PubChem CID 102802319) has the molecular formula C13H20BrN3O and a molecular weight of 314.23 g/mol. Its IUPAC name is [2-(3-bromopropyl)pyrrolidin-1-yl]-(1,3-dimethylpyrazol-4-yl)methanone.
| Compound Name | [2-(3-bromopropyl)pyrrolidin-1-yl]-(1,3-dimethylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 102802319 |
| Molecular Formula | C13H20BrN3O |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | [2-(3-bromopropyl)pyrrolidin-1-yl]-(1,3-dimethylpyrazol-4-yl)methanone |
| SMILES | Cc1nn(C)cc1C(=O)N1CCCC1CCCBr |
| InChI | InChI=1S/C13H20BrN3O/c1-10-12(9-16(2)15-10)13(18)17-8-4-6-11(17)5-3-7-14/h9,11H,3-8H2,1-2H3 |
| InChIKey | OYPFBATZSYMBFZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|