C19H20Cl2F2N4O3 — CID 86657109
[(2S)-2-[[2,6-dichloro-4-(methoxyiminomethyl)phenoxy]methyl]pyrrolidin-1-yl]-[3-(difluoromethyl)-1-methylpyrazol-4-yl]methanone (PubChem CID 86657109) has the molecular formula C19H20Cl2F2N4O3 and a molecular weight of 461.30 g/mol. Its IUPAC name is [(2S)-2-[[2,6-dichloro-4-(methoxyiminomethyl)phenoxy]methyl]pyrrolidin-1-yl]-[3-(difluoromethyl)-1-methylpyrazol-4-yl]methanone.
| Compound Name | [(2S)-2-[[2,6-dichloro-4-(methoxyiminomethyl)phenoxy]methyl]pyrrolidin-1-yl]-[3-(difluoromethyl)-1-methylpyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 86657109 |
| Molecular Formula | C19H20Cl2F2N4O3 |
| Molecular Weight | 461.30 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | [(2S)-2-[[2,6-dichloro-4-(methoxyiminomethyl)phenoxy]methyl]pyrrolidin-1-yl]-[3-(difluoromethyl)-1-methylpyrazol-4-yl]methanone |
| SMILES | CON=Cc1cc(Cl)c(OC[C@@H]2CCCN2C(=O)c2cn(C)nc2C(F)F)c(Cl)c1 |
| InChI | InChI=1S/C19H20Cl2F2N4O3/c1-26-9-13(16(25-26)18(22)23)19(28)27-5-3-4-12(27)10-30-17-14(20)6-11(7-15(17)21)8-24-29-2/h6-9,12,18H,3-5,10H2,1-2H3/t12-/m0/s1 |
| InChIKey | UMRVXWSOUPUFAN-LBPRGKRZSA-N |
| XLogP | 4.33 |
| TPSA | 68.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|