C18H23ClN2O2 — CID 72886711
(3-chloro-1H-indol-2-yl)-[2-(3-methoxypropyl)piperidin-1-yl]methanone (PubChem CID 72886711) has the molecular formula C18H23ClN2O2 and a molecular weight of 334.85 g/mol. Its IUPAC name is (3-chloro-1H-indol-2-yl)-[2-(3-methoxypropyl)piperidin-1-yl]methanone.
| Compound Name | (3-chloro-1H-indol-2-yl)-[2-(3-methoxypropyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 72886711 |
| Molecular Formula | C18H23ClN2O2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (3-chloro-1H-indol-2-yl)-[2-(3-methoxypropyl)piperidin-1-yl]methanone |
| SMILES | COCCCC1CCCCN1C(=O)c1[nH]c2ccccc2c1Cl |
| InChI | InChI=1S/C18H23ClN2O2/c1-23-12-6-8-13-7-4-5-11-21(13)18(22)17-16(19)14-9-2-3-10-15(14)20-17/h2-3,9-10,13,20H,4-8,11-12H2,1H3 |
| InChIKey | RJVRHQYELOVPIW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|