C16H17ClN2O2 — CID 94643496
[(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(3-chloro-1H-indol-2-yl)methanone (PubChem CID 94643496) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is [(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(3-chloro-1H-indol-2-yl)methanone.
| Compound Name | [(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(3-chloro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 94643496 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | [(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(3-chloro-1H-indol-2-yl)methanone |
| SMILES | O=C(c1[nH]c2ccccc2c1Cl)N1CCO[C@@H]2CCC[C@H]21 |
| InChI | InChI=1S/C16H17ClN2O2/c17-14-10-4-1-2-5-11(10)18-15(14)16(20)19-8-9-21-13-7-3-6-12(13)19/h1-2,4-5,12-13,18H,3,6-9H2/t12-,13-/m1/s1 |
| InChIKey | PODCEFSCBAMOTK-CHWSQXEVSA-N |
| XLogP | 3.21 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |