C17H19FN2O2 — CID 95580375
[(4aS,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(4-fluoro-1H-indol-2-yl)methanone (PubChem CID 95580375) has the molecular formula C17H19FN2O2 and a molecular weight of 302.35 g/mol. Its IUPAC name is [(4aS,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(4-fluoro-1H-indol-2-yl)methanone.
| Compound Name | [(4aS,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(4-fluoro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 95580375 |
| Molecular Formula | C17H19FN2O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | [(4aS,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(4-fluoro-1H-indol-2-yl)methanone |
| SMILES | O=C(c1cc2c(F)cccc2[nH]1)N1CCO[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C17H19FN2O2/c18-12-4-3-5-13-11(12)10-14(19-13)17(21)20-8-9-22-16-7-2-1-6-15(16)20/h3-5,10,15-16,19H,1-2,6-9H2/t15-,16-/m0/s1 |
| InChIKey | QPQDXDHOJDSODB-HOTGVXAUSA-N |
| XLogP | 3.09 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |