C14H15BrFNO2 — CID 54979438
3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(4-bromo-2-fluorophenyl)methanone (PubChem CID 54979438) has the molecular formula C14H15BrFNO2 and a molecular weight of 328.18 g/mol. Its IUPAC name is 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(4-bromo-2-fluorophenyl)methanone.
| Compound Name | 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(4-bromo-2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 54979438 |
| Molecular Formula | C14H15BrFNO2 |
| Molecular Weight | 328.18 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(4-bromo-2-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(Br)cc1F)N1CCOC2CCCC21 |
| InChI | InChI=1S/C14H15BrFNO2/c15-9-4-5-10(11(16)8-9)14(18)17-6-7-19-13-3-1-2-12(13)17/h4-5,8,12-13H,1-3,6-7H2 |
| InChIKey | AHXKKMAQMMJQTH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.18 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |