C15H18FNO3 — CID 103940131
2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(2-fluoro-4-hydroxyphenyl)methanone (PubChem CID 103940131) has the molecular formula C15H18FNO3 and a molecular weight of 279.31 g/mol. Its IUPAC name is 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(2-fluoro-4-hydroxyphenyl)methanone.
| Compound Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(2-fluoro-4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 103940131 |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(2-fluoro-4-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)cc1F)N1CCOC2CCCCC21 |
| InChI | InChI=1S/C15H18FNO3/c16-12-9-10(18)5-6-11(12)15(19)17-7-8-20-14-4-2-1-3-13(14)17/h5-6,9,13-14,18H,1-4,7-8H2 |
| InChIKey | MDJDLVVVWJBAPO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |