C16H20FNO3 — CID 106699233
4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-2-fluorobenzoic acid (PubChem CID 106699233) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is 4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-2-fluorobenzoic acid.
| Compound Name | 4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 106699233 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-2-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(CN2CCOC3CCCCC32)cc1F |
| InChI | InChI=1S/C16H20FNO3/c17-13-9-11(5-6-12(13)16(19)20)10-18-7-8-21-15-4-2-1-3-14(15)18/h5-6,9,14-15H,1-4,7-8,10H2,(H,19,20) |
| InChIKey | QVIOFHCLCKGYMX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |