C16H18FNO5 — CID 167801021
4-[2-[(4aS,8aS)-3,4a,5,7,8,8a-hexahydro-2H-[1,4]dioxino[2,3-c]pyridin-6-yl]-2-oxoethyl]-2-fluorobenzoic acid (PubChem CID 167801021) has the molecular formula C16H18FNO5 and a molecular weight of 323.32 g/mol. Its IUPAC name is 4-[2-[(4aS,8aS)-3,4a,5,7,8,8a-hexahydro-2H-[1,4]dioxino[2,3-c]pyridin-6-yl]-2-oxoethyl]-2-fluorobenzoic acid.
| Compound Name | 4-[2-[(4aS,8aS)-3,4a,5,7,8,8a-hexahydro-2H-[1,4]dioxino[2,3-c]pyridin-6-yl]-2-oxoethyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 167801021 |
| Molecular Formula | C16H18FNO5 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 4-[2-[(4aS,8aS)-3,4a,5,7,8,8a-hexahydro-2H-[1,4]dioxino[2,3-c]pyridin-6-yl]-2-oxoethyl]-2-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(CC(=O)N2CC[C@@H]3OCCO[C@H]3C2)cc1F |
| InChI | InChI=1S/C16H18FNO5/c17-12-7-10(1-2-11(12)16(20)21)8-15(19)18-4-3-13-14(9-18)23-6-5-22-13/h1-2,7,13-14H,3-6,8-9H2,(H,20,21)/t13-,14-/m0/s1 |
| InChIKey | MVNVJVNMHXAYSQ-KBPBESRZSA-N |
| XLogP | 1.08 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |