C16H19F2NO3 — CID 124701583
3-[(3R)-1-[2-(3,4-difluorophenyl)acetyl]piperidin-3-yl]propanoic acid (PubChem CID 124701583) has the molecular formula C16H19F2NO3 and a molecular weight of 311.33 g/mol. Its IUPAC name is 3-[(3R)-1-[2-(3,4-difluorophenyl)acetyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3R)-1-[2-(3,4-difluorophenyl)acetyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 124701583 |
| Molecular Formula | C16H19F2NO3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-[(3R)-1-[2-(3,4-difluorophenyl)acetyl]piperidin-3-yl]propanoic acid |
| SMILES | O=C(O)CC[C@H]1CCCN(C(=O)Cc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C16H19F2NO3/c17-13-5-3-12(8-14(13)18)9-15(20)19-7-1-2-11(10-19)4-6-16(21)22/h3,5,8,11H,1-2,4,6-7,9-10H2,(H,21,22)/t11-/m1/s1 |
| InChIKey | TYARPOXTBRLERC-LLVKDONJSA-N |
| XLogP | 2.61 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |