C18H23F2NO — CID 45226907
1-[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]pent-4-en-1-one (PubChem CID 45226907) has the molecular formula C18H23F2NO and a molecular weight of 307.38 g/mol. Its IUPAC name is 1-[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]pent-4-en-1-one.
| Compound Name | 1-[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 45226907 |
| Molecular Formula | C18H23F2NO |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 1-[3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]pent-4-en-1-one |
| SMILES | C=CCCC(=O)N1CCCC(CCc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C18H23F2NO/c1-2-3-6-18(22)21-11-4-5-15(13-21)8-7-14-9-10-16(19)17(20)12-14/h2,9-10,12,15H,1,3-8,11,13H2 |
| InChIKey | ZOANHSMOIIIYEZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|