C15H21BFNO3 — CID 79700459
[3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-5-fluorophenyl]boronic acid (PubChem CID 79700459) has the molecular formula C15H21BFNO3 and a molecular weight of 293.15 g/mol. Its IUPAC name is [3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-5-fluorophenyl]boronic acid.
| Compound Name | [3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-5-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 79700459 |
| Molecular Formula | C15H21BFNO3 |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | [3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-5-fluorophenyl]boronic acid |
| SMILES | OB(O)c1cc(F)cc(CN2CCOC3CCCCC32)c1 |
| InChI | InChI=1S/C15H21BFNO3/c17-13-8-11(7-12(9-13)16(19)20)10-18-5-6-21-15-4-2-1-3-14(15)18/h7-9,14-15,19-20H,1-6,10H2 |
| InChIKey | BHJAOJICRMVIHI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|