C16H23FN2O — CID 107113319
[3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-2-fluorophenyl]methanamine (PubChem CID 107113319) has the molecular formula C16H23FN2O and a molecular weight of 278.37 g/mol. Its IUPAC name is [3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-2-fluorophenyl]methanamine.
| Compound Name | [3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-2-fluorophenyl]methanamine |
|---|---|
| PubChem CID | 107113319 |
| Molecular Formula | C16H23FN2O |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | [3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-2-fluorophenyl]methanamine |
| SMILES | NCc1cccc(CN2CCOC3CCCCC32)c1F |
| InChI | InChI=1S/C16H23FN2O/c17-16-12(10-18)4-3-5-13(16)11-19-8-9-20-15-7-2-1-6-14(15)19/h3-5,14-15H,1-2,6-11,18H2 |
| InChIKey | CBMMOBHKIUVINZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |