C16H21FN2OS — CID 63293024
2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-5-fluorobenzenecarbothioamide (PubChem CID 63293024) has the molecular formula C16H21FN2OS and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-5-fluorobenzenecarbothioamide.
| Compound Name | 2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-5-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 63293024 |
| Molecular Formula | C16H21FN2OS |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-5-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1cc(F)ccc1CN1CCOC2CCCCC21 |
| InChI | InChI=1S/C16H21FN2OS/c17-12-6-5-11(13(9-12)16(18)21)10-19-7-8-20-15-4-2-1-3-14(15)19/h5-6,9,14-15H,1-4,7-8,10H2,(H2,18,21) |
| InChIKey | WBZASHZPKPEBCM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|