C15H15FN2O2S — CID 114513568
2-[(1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)methyl]-5-fluorobenzenecarbothioamide (PubChem CID 114513568) has the molecular formula C15H15FN2O2S and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-[(1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)methyl]-5-fluorobenzenecarbothioamide.
| Compound Name | 2-[(1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)methyl]-5-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 114513568 |
| Molecular Formula | C15H15FN2O2S |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-[(1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)methyl]-5-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1cc(F)ccc1CN1C(=O)C2CCCC2C1=O |
| InChI | InChI=1S/C15H15FN2O2S/c16-9-5-4-8(12(6-9)13(17)21)7-18-14(19)10-2-1-3-11(10)15(18)20/h4-6,10-11H,1-3,7H2,(H2,17,21) |
| InChIKey | RBLZWWUTIKSSLH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|