C16H21FN2S — CID 65320854
2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)-4-fluorobenzenecarbothioamide (PubChem CID 65320854) has the molecular formula C16H21FN2S and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)-4-fluorobenzenecarbothioamide.
| Compound Name | 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)-4-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 65320854 |
| Molecular Formula | C16H21FN2S |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)-4-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(F)cc1CN1CCCC2CCCC21 |
| InChI | InChI=1S/C16H21FN2S/c17-13-6-7-14(16(18)20)12(9-13)10-19-8-2-4-11-3-1-5-15(11)19/h6-7,9,11,15H,1-5,8,10H2,(H2,18,20) |
| InChIKey | HXUUNDGDYJVVGU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|