C16H23N3S — CID 62893453
3-[(2-cyclopentylpyrrolidin-1-yl)methyl]pyridine-2-carbothioamide (PubChem CID 62893453) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is 3-[(2-cyclopentylpyrrolidin-1-yl)methyl]pyridine-2-carbothioamide.
| Compound Name | 3-[(2-cyclopentylpyrrolidin-1-yl)methyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 62893453 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 3-[(2-cyclopentylpyrrolidin-1-yl)methyl]pyridine-2-carbothioamide |
| SMILES | NC(=S)c1ncccc1CN1CCCC1C1CCCC1 |
| InChI | InChI=1S/C16H23N3S/c17-16(20)15-13(7-3-9-18-15)11-19-10-4-8-14(19)12-5-1-2-6-12/h3,7,9,12,14H,1-2,4-6,8,10-11H2,(H2,17,20) |
| InChIKey | VPOMYCPDPREZAO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|