C11H14N4OS — CID 62894984
3-[(3-methyl-2-oxoimidazolidin-1-yl)methyl]pyridine-2-carbothioamide (PubChem CID 62894984) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is 3-[(3-methyl-2-oxoimidazolidin-1-yl)methyl]pyridine-2-carbothioamide.
| Compound Name | 3-[(3-methyl-2-oxoimidazolidin-1-yl)methyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 62894984 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 3-[(3-methyl-2-oxoimidazolidin-1-yl)methyl]pyridine-2-carbothioamide |
| SMILES | CN1CCN(Cc2cccnc2C(N)=S)C1=O |
| InChI | InChI=1S/C11H14N4OS/c1-14-5-6-15(11(14)16)7-8-3-2-4-13-9(8)10(12)17/h2-4H,5-7H2,1H3,(H2,12,17) |
| InChIKey | OAINXCYPIYOYQI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|