C13H16N4O2S — CID 66067734
3-[(2-ethyl-3,5-dioxopiperazin-1-yl)methyl]pyridine-2-carbothioamide (PubChem CID 66067734) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 3-[(2-ethyl-3,5-dioxopiperazin-1-yl)methyl]pyridine-2-carbothioamide.
| Compound Name | 3-[(2-ethyl-3,5-dioxopiperazin-1-yl)methyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 66067734 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 3-[(2-ethyl-3,5-dioxopiperazin-1-yl)methyl]pyridine-2-carbothioamide |
| SMILES | CCC1C(=O)NC(=O)CN1Cc1cccnc1C(N)=S |
| InChI | InChI=1S/C13H16N4O2S/c1-2-9-13(19)16-10(18)7-17(9)6-8-4-3-5-15-11(8)12(14)20/h3-5,9H,2,6-7H2,1H3,(H2,14,20)(H,16,18,19) |
| InChIKey | GRFADZJWYPINGH-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|