C17H24FN3 — CID 107117878
3-[(2-cyclopentylpyrrolidin-1-yl)methyl]-2-fluorobenzenecarboximidamide (PubChem CID 107117878) has the molecular formula C17H24FN3 and a molecular weight of 289.40 g/mol. Its IUPAC name is 3-[(2-cyclopentylpyrrolidin-1-yl)methyl]-2-fluorobenzenecarboximidamide.
| Compound Name | 3-[(2-cyclopentylpyrrolidin-1-yl)methyl]-2-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 107117878 |
| Molecular Formula | C17H24FN3 |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 3-[(2-cyclopentylpyrrolidin-1-yl)methyl]-2-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(CN2CCCC2C2CCCC2)c1F |
| InChI | InChI=1S/C17H24FN3/c18-16-13(7-3-8-14(16)17(19)20)11-21-10-4-9-15(21)12-5-1-2-6-12/h3,7-8,12,15H,1-2,4-6,9-11H2,(H3,19,20) |
| InChIKey | MRJSRDPJDMKCFM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|