C16H24FN3 — CID 107117979
3-[(3,3-diethylpyrrolidin-1-yl)methyl]-2-fluorobenzenecarboximidamide (PubChem CID 107117979) has the molecular formula C16H24FN3 and a molecular weight of 277.39 g/mol. Its IUPAC name is 3-[(3,3-diethylpyrrolidin-1-yl)methyl]-2-fluorobenzenecarboximidamide.
| Compound Name | 3-[(3,3-diethylpyrrolidin-1-yl)methyl]-2-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 107117979 |
| Molecular Formula | C16H24FN3 |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 3-[(3,3-diethylpyrrolidin-1-yl)methyl]-2-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(CN2CCC(CC)(CC)C2)c1F |
| InChI | InChI=1S/C16H24FN3/c1-3-16(4-2)8-9-20(11-16)10-12-6-5-7-13(14(12)17)15(18)19/h5-7H,3-4,8-11H2,1-2H3,(H3,18,19) |
| InChIKey | BUNNOGCKEHGRGP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|