C10H10FN5 — CID 107118050
2-fluoro-3-(1,2,4-triazol-1-ylmethyl)benzenecarboximidamide (PubChem CID 107118050) has the molecular formula C10H10FN5 and a molecular weight of 219.22 g/mol. Its IUPAC name is 2-fluoro-3-(1,2,4-triazol-1-ylmethyl)benzenecarboximidamide.
| Compound Name | 2-fluoro-3-(1,2,4-triazol-1-ylmethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 107118050 |
| Molecular Formula | C10H10FN5 |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-fluoro-3-(1,2,4-triazol-1-ylmethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(Cn2cncn2)c1F |
| InChI | InChI=1S/C10H10FN5/c11-9-7(4-16-6-14-5-15-16)2-1-3-8(9)10(12)13/h1-3,5-6H,4H2,(H3,12,13) |
| InChIKey | WJZZJZDATFBZKP-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|