C11H12FN5S — CID 107118452
2-fluoro-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzenecarboximidamide (PubChem CID 107118452) has the molecular formula C11H12FN5S and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-fluoro-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzenecarboximidamide.
| Compound Name | 2-fluoro-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 107118452 |
| Molecular Formula | C11H12FN5S |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 2-fluoro-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(CSc2nncn2C)c1F |
| InChI | InChI=1S/C11H12FN5S/c1-17-6-15-16-11(17)18-5-7-3-2-4-8(9(7)12)10(13)14/h2-4,6H,5H2,1H3,(H3,13,14) |
| InChIKey | BVABZIRYOXYQEA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|