C10H11FN4S — CID 107349767
2-fluoro-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]aniline (PubChem CID 107349767) has the molecular formula C10H11FN4S and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-fluoro-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]aniline.
| Compound Name | 2-fluoro-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]aniline |
|---|---|
| PubChem CID | 107349767 |
| Molecular Formula | C10H11FN4S |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 2-fluoro-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]aniline |
| SMILES | Cn1cnnc1SCc1cccc(N)c1F |
| InChI | InChI=1S/C10H11FN4S/c1-15-6-13-14-10(15)16-5-7-3-2-4-8(12)9(7)11/h2-4,6H,5,12H2,1H3 |
| InChIKey | LRVCKUJHHLPOGN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|