C11H12FN5OS — CID 107118364
2-fluoro-N'-hydroxy-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzenecarboximidamide (PubChem CID 107118364) has the molecular formula C11H12FN5OS and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-fluoro-N'-hydroxy-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzenecarboximidamide.
| Compound Name | 2-fluoro-N'-hydroxy-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 107118364 |
| Molecular Formula | C11H12FN5OS |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-fluoro-N'-hydroxy-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzenecarboximidamide |
| SMILES | Cn1cnnc1SCc1cccc(/C(N)=N/O)c1F |
| InChI | InChI=1S/C11H12FN5OS/c1-17-6-14-15-11(17)19-5-7-3-2-4-8(9(7)12)10(13)16-18/h2-4,6,18H,5H2,1H3,(H2,13,16) |
| InChIKey | GLGGGHOZNLHWAH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|