C12H10F4N4O — CID 107117555
2-fluoro-N'-hydroxy-3-[[4-(trifluoromethyl)pyrazol-1-yl]methyl]benzenecarboximidamide (PubChem CID 107117555) has the molecular formula C12H10F4N4O and a molecular weight of 302.23 g/mol. Its IUPAC name is 2-fluoro-N'-hydroxy-3-[[4-(trifluoromethyl)pyrazol-1-yl]methyl]benzenecarboximidamide.
| Compound Name | 2-fluoro-N'-hydroxy-3-[[4-(trifluoromethyl)pyrazol-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 107117555 |
| Molecular Formula | C12H10F4N4O |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-fluoro-N'-hydroxy-3-[[4-(trifluoromethyl)pyrazol-1-yl]methyl]benzenecarboximidamide |
| SMILES | N/C(=N/O)c1cccc(Cn2cc(C(F)(F)F)cn2)c1F |
| InChI | InChI=1S/C12H10F4N4O/c13-10-7(2-1-3-9(10)11(17)19-21)5-20-6-8(4-18-20)12(14,15)16/h1-4,6,21H,5H2,(H2,17,19) |
| InChIKey | IDYJJLSRUKDRQV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|