C14H18FN5O — CID 107463393
3-[[(3-ethyl-1-methylpyrazol-4-yl)amino]methyl]-2-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 107463393) has the molecular formula C14H18FN5O and a molecular weight of 291.33 g/mol. Its IUPAC name is 3-[[(3-ethyl-1-methylpyrazol-4-yl)amino]methyl]-2-fluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-[[(3-ethyl-1-methylpyrazol-4-yl)amino]methyl]-2-fluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 107463393 |
| Molecular Formula | C14H18FN5O |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 3-[[(3-ethyl-1-methylpyrazol-4-yl)amino]methyl]-2-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | CCc1nn(C)cc1NCc1cccc(/C(N)=N/O)c1F |
| InChI | InChI=1S/C14H18FN5O/c1-3-11-12(8-20(2)18-11)17-7-9-5-4-6-10(13(9)15)14(16)19-21/h4-6,8,17,21H,3,7H2,1-2H3,(H2,16,19) |
| InChIKey | MIYYKTPAZHQZLF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|