C9H12FN3O — CID 107116628
2-fluoro-N'-hydroxy-3-(methylaminomethyl)benzenecarboximidamide (PubChem CID 107116628) has the molecular formula C9H12FN3O and a molecular weight of 197.21 g/mol. Its IUPAC name is 2-fluoro-N'-hydroxy-3-(methylaminomethyl)benzenecarboximidamide.
| Compound Name | 2-fluoro-N'-hydroxy-3-(methylaminomethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 107116628 |
| Molecular Formula | C9H12FN3O |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2-fluoro-N'-hydroxy-3-(methylaminomethyl)benzenecarboximidamide |
| SMILES | CNCc1cccc(/C(N)=N/O)c1F |
| InChI | InChI=1S/C9H12FN3O/c1-12-5-6-3-2-4-7(8(6)10)9(11)13-14/h2-4,12,14H,5H2,1H3,(H2,11,13) |
| InChIKey | KEAMOOWULITTFG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|