C14H23FN4O — CID 107117103
3-[[[2-(dimethylamino)-2-methylpropyl]amino]methyl]-2-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 107117103) has the molecular formula C14H23FN4O and a molecular weight of 282.36 g/mol. Its IUPAC name is 3-[[[2-(dimethylamino)-2-methylpropyl]amino]methyl]-2-fluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-[[[2-(dimethylamino)-2-methylpropyl]amino]methyl]-2-fluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 107117103 |
| Molecular Formula | C14H23FN4O |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 3-[[[2-(dimethylamino)-2-methylpropyl]amino]methyl]-2-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | CN(C)C(C)(C)CNCc1cccc(/C(N)=N/O)c1F |
| InChI | InChI=1S/C14H23FN4O/c1-14(2,19(3)4)9-17-8-10-6-5-7-11(12(10)15)13(16)18-20/h5-7,17,20H,8-9H2,1-4H3,(H2,16,18) |
| InChIKey | TUZANGCHPILUPK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|