C10H10FN5OS — CID 107118354
2-fluoro-N'-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzenecarboximidamide (PubChem CID 107118354) has the molecular formula C10H10FN5OS and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-fluoro-N'-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzenecarboximidamide.
| Compound Name | 2-fluoro-N'-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 107118354 |
| Molecular Formula | C10H10FN5OS |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-fluoro-N'-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzenecarboximidamide |
| SMILES | N/C(=N/O)c1cccc(CSc2ncn[nH]2)c1F |
| InChI | InChI=1S/C10H10FN5OS/c11-8-6(4-18-10-13-5-14-15-10)2-1-3-7(8)9(12)16-17/h1-3,5,17H,4H2,(H2,12,16)(H,13,14,15) |
| InChIKey | GMZBZTRZYSSGMA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|