C4H7N5OS — CID 71393351
N'-hydroxy-2-(1H-1,2,4-triazol-5-ylsulfanyl)ethanimidamide (PubChem CID 71393351) has the molecular formula C4H7N5OS and a molecular weight of 173.20 g/mol. Its IUPAC name is N'-hydroxy-2-(1H-1,2,4-triazol-5-ylsulfanyl)ethanimidamide.
| Compound Name | N'-hydroxy-2-(1H-1,2,4-triazol-5-ylsulfanyl)ethanimidamide |
|---|---|
| PubChem CID | 71393351 |
| Molecular Formula | C4H7N5OS |
| Molecular Weight | 173.20 g/mol |
| Exact Mass | 173.04 |
| IUPAC Name | N'-hydroxy-2-(1H-1,2,4-triazol-5-ylsulfanyl)ethanimidamide |
| SMILES | NC(CSc1ncn[nH]1)=NO |
| InChI | InChI=1S/C4H7N5OS/c5-3(9-10)1-11-4-6-2-7-8-4/h2,10H,1H2,(H2,5,9)(H,6,7,8) |
| InChIKey | PJULDPHODXNDTA-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.20 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|