C5H9N3OS — CID 106933255
(2S)-1-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol (PubChem CID 106933255) has the molecular formula C5H9N3OS and a molecular weight of 159.21 g/mol. Its IUPAC name is (2S)-1-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol.
| Compound Name | (2S)-1-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol |
|---|---|
| PubChem CID | 106933255 |
| Molecular Formula | C5H9N3OS |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | (2S)-1-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol |
| SMILES | C[C@H](O)CSc1ncn[nH]1 |
| InChI | InChI=1S/C5H9N3OS/c1-4(9)2-10-5-6-3-7-8-5/h3-4,9H,2H2,1H3,(H,6,7,8)/t4-/m0/s1 |
| InChIKey | SLIREXQDTHEMKI-BYPYZUCNSA-N |
| XLogP | 0.28 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |