C11H13N3O2S — CID 2842739
1-phenoxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol (PubChem CID 2842739) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 1-phenoxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol.
| Compound Name | 1-phenoxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol |
|---|---|
| PubChem CID | 2842739 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 1-phenoxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol |
| SMILES | OC(COc1ccccc1)CSc1ncn[nH]1 |
| InChI | InChI=1S/C11H13N3O2S/c15-9(7-17-11-12-8-13-14-11)6-16-10-4-2-1-3-5-10/h1-5,8-9,15H,6-7H2,(H,12,13,14) |
| InChIKey | XBRHTSGLTMDDHF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |