C12H13N3O2S3 — CID 118963290
6-(2-hydroxy-3-phenoxypropyl)sulfanyl-1H-1,3,5-triazine-2,4-dithione (PubChem CID 118963290) has the molecular formula C12H13N3O2S3 and a molecular weight of 327.46 g/mol. Its IUPAC name is 6-(2-hydroxy-3-phenoxypropyl)sulfanyl-1H-1,3,5-triazine-2,4-dithione.
| Compound Name | 6-(2-hydroxy-3-phenoxypropyl)sulfanyl-1H-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 118963290 |
| Molecular Formula | C12H13N3O2S3 |
| Molecular Weight | 327.46 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 6-(2-hydroxy-3-phenoxypropyl)sulfanyl-1H-1,3,5-triazine-2,4-dithione |
| SMILES | OC(COc1ccccc1)CSc1nc(=S)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C12H13N3O2S3/c16-8(6-17-9-4-2-1-3-5-9)7-20-12-14-10(18)13-11(19)15-12/h1-5,8,16H,6-7H2,(H2,13,14,15,18,19) |
| InChIKey | OMROLVWKIHRMQM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 73.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|