About 1-piperazin-1-yl-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol
1-piperazin-1-yl-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol (PubChem CID 65449465) has the molecular formula C9H17N5OS
and a molecular weight of 243.34 g/mol. Its IUPAC name is 1-piperazin-1-yl-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol.
Molecular Properties
| Compound Name | 1-piperazin-1-yl-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol |
| PubChem CID | 65449465 |
| Molecular Formula | C9H17N5OS |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 1-piperazin-1-yl-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol |
| SMILES | OC(CSc1ncn[nH]1)CN1CCNCC1 |
| InChI | InChI=1S/C9H17N5OS/c15-8(5-14-3-1-10-2-4-14)6-16-9-11-7-12-13-9/h7-8,10,15H,1-6H2,(H,11,12,13) |
| InChIKey | GMXJFKZIDPBTKV-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-piperazin-1-yl-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperazin-1-yl-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol?
The IUPAC name of 1-piperazin-1-yl-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol (CID 65449465) is 1-piperazin-1-yl-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol.
What is the SMILES notation for 1-piperazin-1-yl-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol?
The canonical SMILES for 1-piperazin-1-yl-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol is OC(CSc1ncn[nH]1)CN1CCNCC1.
What is the InChIKey of 1-piperazin-1-yl-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol?
The InChIKey is GMXJFKZIDPBTKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N5OS/c15-8(5-14-3-1-10-2-4-14)6-16-9-11-7-12-13-9/h7-8,10,15H,1-6H2,(H,11,12,13).
What are the key properties of 1-piperazin-1-yl-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol?
1-piperazin-1-yl-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol has a molecular weight of 243.34 g/mol, XLogP of -0.84, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperazin-1-yl-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-2-ol is sourced from PubChem (CID 65449465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).