C7H12N4S — CID 103068229
N-methyl-2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)prop-2-en-1-amine (PubChem CID 103068229) has the molecular formula C7H12N4S and a molecular weight of 184.27 g/mol. Its IUPAC name is N-methyl-2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)prop-2-en-1-amine.
| Compound Name | N-methyl-2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 103068229 |
| Molecular Formula | C7H12N4S |
| Molecular Weight | 184.27 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | N-methyl-2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)prop-2-en-1-amine |
| SMILES | C=C(CNC)CSc1ncn[nH]1 |
| InChI | InChI=1S/C7H12N4S/c1-6(3-8-2)4-12-7-9-5-10-11-7/h5,8H,1,3-4H2,2H3,(H,9,10,11) |
| InChIKey | FPMKJLBWOZKWBD-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|