C9H16N4OS — CID 7784986
N-pentan-3-yl-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide (PubChem CID 7784986) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is N-pentan-3-yl-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide.
| Compound Name | N-pentan-3-yl-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 7784986 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | N-pentan-3-yl-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
| SMILES | CCC(CC)NC(=O)CSc1ncn[nH]1 |
| InChI | InChI=1S/C9H16N4OS/c1-3-7(4-2)12-8(14)5-15-9-10-6-11-13-9/h6-7H,3-5H2,1-2H3,(H,12,14)(H,10,11,13) |
| InChIKey | OZIXVZOTBDBWNT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |