C7H9N3O2S — CID 22414245
1-(1H-1,2,4-triazol-5-ylsulfanyl)pentane-2,4-dione (PubChem CID 22414245) has the molecular formula C7H9N3O2S and a molecular weight of 199.23 g/mol. Its IUPAC name is 1-(1H-1,2,4-triazol-5-ylsulfanyl)pentane-2,4-dione.
| Compound Name | 1-(1H-1,2,4-triazol-5-ylsulfanyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 22414245 |
| Molecular Formula | C7H9N3O2S |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 1-(1H-1,2,4-triazol-5-ylsulfanyl)pentane-2,4-dione |
| SMILES | CC(=O)CC(=O)CSc1ncn[nH]1 |
| InChI | InChI=1S/C7H9N3O2S/c1-5(11)2-6(12)3-13-7-8-4-9-10-7/h4H,2-3H2,1H3,(H,8,9,10) |
| InChIKey | PDKRGKGUVHDTMU-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|