About 6-(1H-1,2,4-triazol-5-ylsulfanyl)hexan-3-one
6-(1H-1,2,4-triazol-5-ylsulfanyl)hexan-3-one (PubChem CID 104623456) has the molecular formula C8H13N3OS
and a molecular weight of 199.28 g/mol. Its IUPAC name is 6-(1H-1,2,4-triazol-5-ylsulfanyl)hexan-3-one.
Molecular Properties
| Compound Name | 6-(1H-1,2,4-triazol-5-ylsulfanyl)hexan-3-one |
| PubChem CID | 104623456 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 6-(1H-1,2,4-triazol-5-ylsulfanyl)hexan-3-one |
| SMILES | CCC(=O)CCCSc1ncn[nH]1 |
| InChI | InChI=1S/C8H13N3OS/c1-2-7(12)4-3-5-13-8-9-6-10-11-8/h6H,2-5H2,1H3,(H,9,10,11) |
| InChIKey | RXVBFHZKZCALKQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(1H-1,2,4-triazol-5-ylsulfanyl)hexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1H-1,2,4-triazol-5-ylsulfanyl)hexan-3-one?
The IUPAC name of 6-(1H-1,2,4-triazol-5-ylsulfanyl)hexan-3-one (CID 104623456) is 6-(1H-1,2,4-triazol-5-ylsulfanyl)hexan-3-one.
What is the SMILES notation for 6-(1H-1,2,4-triazol-5-ylsulfanyl)hexan-3-one?
The canonical SMILES for 6-(1H-1,2,4-triazol-5-ylsulfanyl)hexan-3-one is CCC(=O)CCCSc1ncn[nH]1.
What is the InChIKey of 6-(1H-1,2,4-triazol-5-ylsulfanyl)hexan-3-one?
The InChIKey is RXVBFHZKZCALKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3OS/c1-2-7(12)4-3-5-13-8-9-6-10-11-8/h6H,2-5H2,1H3,(H,9,10,11).
What are the key properties of 6-(1H-1,2,4-triazol-5-ylsulfanyl)hexan-3-one?
6-(1H-1,2,4-triazol-5-ylsulfanyl)hexan-3-one has a molecular weight of 199.28 g/mol, XLogP of 1.66, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1H-1,2,4-triazol-5-ylsulfanyl)hexan-3-one is sourced from PubChem (CID 104623456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).