C8H13N3OS — CID 104623456
6-(1H-1,2,4-triazol-5-ylsulfanyl)hexan-3-one (PubChem CID 104623456) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is 6-(1H-1,2,4-triazol-5-ylsulfanyl)hexan-3-one.
| Compound Name | 6-(1H-1,2,4-triazol-5-ylsulfanyl)hexan-3-one |
|---|---|
| PubChem CID | 104623456 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 6-(1H-1,2,4-triazol-5-ylsulfanyl)hexan-3-one |
| SMILES | CCC(=O)CCCSc1ncn[nH]1 |
| InChI | InChI=1S/C8H13N3OS/c1-2-7(12)4-3-5-13-8-9-6-10-11-8/h6H,2-5H2,1H3,(H,9,10,11) |
| InChIKey | RXVBFHZKZCALKQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|