C6H9N3O2S — CID 799674
ethyl 2-(1H-1,2,4-triazol-5-ylsulfanyl)acetate (PubChem CID 799674) has the molecular formula C6H9N3O2S and a molecular weight of 187.22 g/mol. Its IUPAC name is ethyl 2-(1H-1,2,4-triazol-5-ylsulfanyl)acetate.
| Compound Name | ethyl 2-(1H-1,2,4-triazol-5-ylsulfanyl)acetate |
|---|---|
| PubChem CID | 799674 |
| Molecular Formula | C6H9N3O2S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | ethyl 2-(1H-1,2,4-triazol-5-ylsulfanyl)acetate |
| SMILES | CCOC(=O)CSc1ncn[nH]1 |
| InChI | InChI=1S/C6H9N3O2S/c1-2-11-5(10)3-12-6-7-4-8-9-6/h4H,2-3H2,1H3,(H,7,8,9) |
| InChIKey | KWRBZESLGXYFOV-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |