C12H13N3O2S — CID 720627
ethyl (2S)-2-phenyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetate (PubChem CID 720627) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is ethyl (2S)-2-phenyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetate.
| Compound Name | ethyl (2S)-2-phenyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetate |
|---|---|
| PubChem CID | 720627 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | ethyl (2S)-2-phenyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetate |
| SMILES | CCOC(=O)[C@@H](Sc1ncn[nH]1)c1ccccc1 |
| InChI | InChI=1S/C12H13N3O2S/c1-2-17-11(16)10(9-6-4-3-5-7-9)18-12-13-8-14-15-12/h3-8,10H,2H2,1H3,(H,13,14,15)/t10-/m0/s1 |
| InChIKey | UHHZCHZIWBVAHD-JTQLQIEISA-N |
| XLogP | 2.20 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |