C11H13N5S — CID 62779768
3-phenyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)propanimidamide (PubChem CID 62779768) has the molecular formula C11H13N5S and a molecular weight of 247.33 g/mol. Its IUPAC name is 3-phenyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)propanimidamide.
| Compound Name | 3-phenyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)propanimidamide |
|---|---|
| PubChem CID | 62779768 |
| Molecular Formula | C11H13N5S |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 3-phenyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)propanimidamide |
| SMILES | [H]/N=C(\N)CC(Sc1ncn[nH]1)c1ccccc1 |
| InChI | InChI=1S/C11H13N5S/c12-10(13)6-9(8-4-2-1-3-5-8)17-11-14-7-15-16-11/h1-5,7,9H,6H2,(H3,12,13)(H,14,15,16) |
| InChIKey | NBCKKGDOQWVJOW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|