C16H15N3OS — CID 62778782
3-(1,3-benzoxazol-2-ylsulfanyl)-3-phenylpropanimidamide (PubChem CID 62778782) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-ylsulfanyl)-3-phenylpropanimidamide.
| Compound Name | 3-(1,3-benzoxazol-2-ylsulfanyl)-3-phenylpropanimidamide |
|---|---|
| PubChem CID | 62778782 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 3-(1,3-benzoxazol-2-ylsulfanyl)-3-phenylpropanimidamide |
| SMILES | [H]/N=C(\N)CC(Sc1nc2ccccc2o1)c1ccccc1 |
| InChI | InChI=1S/C16H15N3OS/c17-15(18)10-14(11-6-2-1-3-7-11)21-16-19-12-8-4-5-9-13(12)20-16/h1-9,14H,10H2,(H3,17,18) |
| InChIKey | XZJOHBYPURJLAY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 75.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|