C11H13N3O2S — CID 54945094
3-(1,3-benzoxazol-2-ylsulfanyl)-N'-hydroxybutanimidamide (PubChem CID 54945094) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-ylsulfanyl)-N'-hydroxybutanimidamide.
| Compound Name | 3-(1,3-benzoxazol-2-ylsulfanyl)-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 54945094 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 3-(1,3-benzoxazol-2-ylsulfanyl)-N'-hydroxybutanimidamide |
| SMILES | CC(C/C(N)=N/O)Sc1nc2ccccc2o1 |
| InChI | InChI=1S/C11H13N3O2S/c1-7(6-10(12)14-15)17-11-13-8-4-2-3-5-9(8)16-11/h2-5,7,15H,6H2,1H3,(H2,12,14) |
| InChIKey | PDSVXGZIABSTTJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|