C13H17N3O2S — CID 64709546
2-amino-4-(1,3-benzoxazol-2-ylsulfanyl)-2-methylpentanamide (PubChem CID 64709546) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is 2-amino-4-(1,3-benzoxazol-2-ylsulfanyl)-2-methylpentanamide.
| Compound Name | 2-amino-4-(1,3-benzoxazol-2-ylsulfanyl)-2-methylpentanamide |
|---|---|
| PubChem CID | 64709546 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-amino-4-(1,3-benzoxazol-2-ylsulfanyl)-2-methylpentanamide |
| SMILES | CC(CC(C)(N)C(N)=O)Sc1nc2ccccc2o1 |
| InChI | InChI=1S/C13H17N3O2S/c1-8(7-13(2,15)11(14)17)19-12-16-9-5-3-4-6-10(9)18-12/h3-6,8H,7,15H2,1-2H3,(H2,14,17) |
| InChIKey | KRLZJUOJTFWNLG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |