C12H11Cl3N2O3S — CID 2887367
ethyl N-[1-(1,3-benzoxazol-2-ylsulfanyl)-2,2,2-trichloroethyl]carbamate (PubChem CID 2887367) has the molecular formula C12H11Cl3N2O3S and a molecular weight of 369.66 g/mol. Its IUPAC name is ethyl N-[1-(1,3-benzoxazol-2-ylsulfanyl)-2,2,2-trichloroethyl]carbamate.
| Compound Name | ethyl N-[1-(1,3-benzoxazol-2-ylsulfanyl)-2,2,2-trichloroethyl]carbamate |
|---|---|
| PubChem CID | 2887367 |
| Molecular Formula | C12H11Cl3N2O3S |
| Molecular Weight | 369.66 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | ethyl N-[1-(1,3-benzoxazol-2-ylsulfanyl)-2,2,2-trichloroethyl]carbamate |
| SMILES | CCOC(=O)NC(Sc1nc2ccccc2o1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H11Cl3N2O3S/c1-2-19-10(18)17-9(12(13,14)15)21-11-16-7-5-3-4-6-8(7)20-11/h3-6,9H,2H2,1H3,(H,17,18) |
| InChIKey | KSLRQMFAYDXRIO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.66 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|