C12H12Cl3N3O2S — CID 1102799
3-[(1R)-1-(1,3-benzoxazol-2-ylsulfanyl)-2,2,2-trichloroethyl]-1,1-dimethylurea (PubChem CID 1102799) has the molecular formula C12H12Cl3N3O2S and a molecular weight of 368.67 g/mol. Its IUPAC name is 3-[(1R)-1-(1,3-benzoxazol-2-ylsulfanyl)-2,2,2-trichloroethyl]-1,1-dimethylurea.
| Compound Name | 3-[(1R)-1-(1,3-benzoxazol-2-ylsulfanyl)-2,2,2-trichloroethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 1102799 |
| Molecular Formula | C12H12Cl3N3O2S |
| Molecular Weight | 368.67 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | 3-[(1R)-1-(1,3-benzoxazol-2-ylsulfanyl)-2,2,2-trichloroethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)N[C@H](Sc1nc2ccccc2o1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H12Cl3N3O2S/c1-18(2)10(19)17-9(12(13,14)15)21-11-16-7-5-3-4-6-8(7)20-11/h3-6,9H,1-2H3,(H,17,19)/t9-/m1/s1 |
| InChIKey | QVYYSRZPBYXUSU-SECBINFHSA-N |
| XLogP | 3.89 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.67 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|